C30H33ClF2N2O3 — CID 142257105
[(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(2-fluorophenyl)-N-[(4-fluorophenyl)methyl]carbamate chloride (PubChem CID 142257105) has the molecular formula C30H33ClF2N2O3 and a molecular weight of 543.05 g/mol. Its IUPAC name is [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(2-fluorophenyl)-N-[(4-fluorophenyl)methyl]carbamate chloride.
| Compound Name | [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(2-fluorophenyl)-N-[(4-fluorophenyl)methyl]carbamate chloride |
|---|---|
| PubChem CID | 142257105 |
| Molecular Formula | C30H33ClF2N2O3 |
| Molecular Weight | 543.05 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(2-fluorophenyl)-N-[(4-fluorophenyl)methyl]carbamate chloride |
| SMILES | O=C(O[C@H]1C[N+]2(CCCOc3ccccc3)CCC1CC2)N(Cc1ccc(F)cc1)c1ccccc1F.[Cl-] |
| InChI | InChI=1S/C30H33F2N2O3.ClH/c31-25-13-11-23(12-14-25)21-33(28-10-5-4-9-27(28)32)30(35)37-29-22-34(18-15-24(29)16-19-34)17-6-20-36-26-7-2-1-3-8-26;/h1-5,7-14,24,29H,6,15-22H2;1H/q+1;/p-1/t24?,29-,34?;/m0./s1 |
| InChIKey | IMSCYZLSYFTRPR-CYFCJVRHSA-M |
| XLogP | 3.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.05 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|