C30H31F4N2O3+ — CID 69275856
[1-[3-(2,4-difluorophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-(2-fluorophenyl)-N-[(4-fluorophenyl)methyl]carbamate (PubChem CID 69275856) has the molecular formula C30H31F4N2O3+ and a molecular weight of 543.58 g/mol. Its IUPAC name is [1-[3-(2,4-difluorophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-(2-fluorophenyl)-N-[(4-fluorophenyl)methyl]carbamate.
| Compound Name | [1-[3-(2,4-difluorophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-(2-fluorophenyl)-N-[(4-fluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 69275856 |
| Molecular Formula | C30H31F4N2O3+ |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | [1-[3-(2,4-difluorophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-(2-fluorophenyl)-N-[(4-fluorophenyl)methyl]carbamate |
| SMILES | O=C(OC1C[N+]2(CCCOc3ccc(F)cc3F)CCC1CC2)N(Cc1ccc(F)cc1)c1ccccc1F |
| InChI | InChI=1S/C30H31F4N2O3/c31-23-8-6-21(7-9-23)19-35(27-5-2-1-4-25(27)33)30(37)39-29-20-36(15-12-22(29)13-16-36)14-3-17-38-28-11-10-24(32)18-26(28)34/h1-2,4-11,18,22,29H,3,12-17,19-20H2/q+1 |
| InChIKey | CTGRVSJFOYCTMJ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|