C29H32F2N3O2S+ — CID 69278080
[1-(3-pyridin-4-ylsulfanylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(2-fluorophenyl)-N-[(4-fluorophenyl)methyl]carbamate (PubChem CID 69278080) has the molecular formula C29H32F2N3O2S+ and a molecular weight of 524.66 g/mol. Its IUPAC name is [1-(3-pyridin-4-ylsulfanylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(2-fluorophenyl)-N-[(4-fluorophenyl)methyl]carbamate.
| Compound Name | [1-(3-pyridin-4-ylsulfanylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(2-fluorophenyl)-N-[(4-fluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 69278080 |
| Molecular Formula | C29H32F2N3O2S+ |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | [1-(3-pyridin-4-ylsulfanylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(2-fluorophenyl)-N-[(4-fluorophenyl)methyl]carbamate |
| SMILES | O=C(OC1C[N+]2(CCCSc3ccncc3)CCC1CC2)N(Cc1ccc(F)cc1)c1ccccc1F |
| InChI | InChI=1S/C29H32F2N3O2S/c30-24-8-6-22(7-9-24)20-33(27-5-2-1-4-26(27)31)29(35)36-28-21-34(17-12-23(28)13-18-34)16-3-19-37-25-10-14-32-15-11-25/h1-2,4-11,14-15,23,28H,3,12-13,16-21H2/q+1 |
| InChIKey | MBLSNJWVCGGESJ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|