C30H32F3N2O2+ — CID 69276392
[1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(3,4-difluorophenyl)methyl]-N-(3-fluorophenyl)carbamate (PubChem CID 69276392) has the molecular formula C30H32F3N2O2+ and a molecular weight of 509.59 g/mol. Its IUPAC name is [1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(3,4-difluorophenyl)methyl]-N-(3-fluorophenyl)carbamate.
| Compound Name | [1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(3,4-difluorophenyl)methyl]-N-(3-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 69276392 |
| Molecular Formula | C30H32F3N2O2+ |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | [1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(3,4-difluorophenyl)methyl]-N-(3-fluorophenyl)carbamate |
| SMILES | O=C(OC1C[N+]2(CCCc3ccccc3)CCC1CC2)N(Cc1ccc(F)c(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C30H32F3N2O2/c31-25-9-4-10-26(19-25)34(20-23-11-12-27(32)28(33)18-23)30(36)37-29-21-35(16-13-24(29)14-17-35)15-5-8-22-6-2-1-3-7-22/h1-4,6-7,9-12,18-19,24,29H,5,8,13-17,20-21H2/q+1 |
| InChIKey | BFEQAUGVPSEOIR-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|