C31H36BrFN2O2 — CID 157226460
[(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(4-fluorophenyl)methyl]-N-(3-methylphenyl)carbamate bromide (PubChem CID 157226460) has the molecular formula C31H36BrFN2O2 and a molecular weight of 567.54 g/mol. Its IUPAC name is [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(4-fluorophenyl)methyl]-N-(3-methylphenyl)carbamate bromide.
| Compound Name | [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(4-fluorophenyl)methyl]-N-(3-methylphenyl)carbamate bromide |
|---|---|
| PubChem CID | 157226460 |
| Molecular Formula | C31H36BrFN2O2 |
| Molecular Weight | 567.54 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(4-fluorophenyl)methyl]-N-(3-methylphenyl)carbamate bromide |
| SMILES | Cc1cccc(N(Cc2ccc(F)cc2)C(=O)O[C@H]2C[N+]3(CCCc4ccccc4)CCC2CC3)c1.[Br-] |
| InChI | InChI=1S/C31H36FN2O2.BrH/c1-24-7-5-11-29(21-24)33(22-26-12-14-28(32)15-13-26)31(35)36-30-23-34(19-16-27(30)17-20-34)18-6-10-25-8-3-2-4-9-25;/h2-5,7-9,11-15,21,27,30H,6,10,16-20,22-23H2,1H3;1H/q+1;/p-1/t27?,30-,34?;/m0./s1 |
| InChIKey | ATPACEFJHNEDKE-JJVJZZIASA-M |
| XLogP | 3.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|