C31H36BrFN2O4 — CID 160935086
[(3R)-1-[2-(2,5-dimethoxyphenyl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(4-fluorophenyl)methyl]-N-phenylcarbamate bromide (PubChem CID 160935086) has the molecular formula C31H36BrFN2O4 and a molecular weight of 599.54 g/mol. Its IUPAC name is [(3R)-1-[2-(2,5-dimethoxyphenyl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(4-fluorophenyl)methyl]-N-phenylcarbamate bromide.
| Compound Name | [(3R)-1-[2-(2,5-dimethoxyphenyl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(4-fluorophenyl)methyl]-N-phenylcarbamate bromide |
|---|---|
| PubChem CID | 160935086 |
| Molecular Formula | C31H36BrFN2O4 |
| Molecular Weight | 599.54 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | [(3R)-1-[2-(2,5-dimethoxyphenyl)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(4-fluorophenyl)methyl]-N-phenylcarbamate bromide |
| SMILES | COc1ccc(OC)c(CC[N+]23CCC(CC2)[C@@H](OC(=O)N(Cc2ccc(F)cc2)c2ccccc2)C3)c1.[Br-] |
| InChI | InChI=1S/C31H36FN2O4.BrH/c1-36-28-12-13-29(37-2)25(20-28)16-19-34-17-14-24(15-18-34)30(22-34)38-31(35)33(27-6-4-3-5-7-27)21-23-8-10-26(32)11-9-23;/h3-13,20,24,30H,14-19,21-22H2,1-2H3;1H/q+1;/p-1/t24?,30-,34?;/m0./s1 |
| InChIKey | STTTWERGYLRUQR-CRCXTLEESA-M |
| XLogP | 2.84 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|