C30H33F2N2O3+ — CID 69274738
[(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(3,4-difluorophenyl)methyl]-N-(3-methylphenyl)carbamate (PubChem CID 69274738) has the molecular formula C30H33F2N2O3+ and a molecular weight of 507.60 g/mol. Its IUPAC name is [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(3,4-difluorophenyl)methyl]-N-(3-methylphenyl)carbamate.
| Compound Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(3,4-difluorophenyl)methyl]-N-(3-methylphenyl)carbamate |
|---|---|
| PubChem CID | 69274738 |
| Molecular Formula | C30H33F2N2O3+ |
| Molecular Weight | 507.60 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(3,4-difluorophenyl)methyl]-N-(3-methylphenyl)carbamate |
| SMILES | Cc1cccc(N(Cc2ccc(F)c(F)c2)C(=O)O[C@H]2C[N+]3(CCOc4ccccc4)CCC2CC3)c1 |
| InChI | InChI=1S/C30H33F2N2O3/c1-22-6-5-7-25(18-22)33(20-23-10-11-27(31)28(32)19-23)30(35)37-29-21-34(14-12-24(29)13-15-34)16-17-36-26-8-3-2-4-9-26/h2-11,18-19,24,29H,12-17,20-21H2,1H3/q+1/t24?,29-,34?/m0/s1 |
| InChIKey | KLCPUHWGDQZIQK-JCBDZXOXSA-N |
| XLogP | 6.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.60 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|