C30H34FN2O2+ — CID 172757488
[(3R)-1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(4-fluorophenyl)methyl]-N-(3-methylphenyl)carbamate (PubChem CID 172757488) has the molecular formula C30H34FN2O2+ and a molecular weight of 473.61 g/mol. Its IUPAC name is [(3R)-1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(4-fluorophenyl)methyl]-N-(3-methylphenyl)carbamate.
| Compound Name | [(3R)-1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(4-fluorophenyl)methyl]-N-(3-methylphenyl)carbamate |
|---|---|
| PubChem CID | 172757488 |
| Molecular Formula | C30H34FN2O2+ |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | [(3R)-1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(4-fluorophenyl)methyl]-N-(3-methylphenyl)carbamate |
| SMILES | Cc1cccc(N(Cc2ccc(F)cc2)C(=O)O[C@H]2C[N+]3(C(C)c4ccccc4)CCC2CC3)c1 |
| InChI | InChI=1S/C30H34FN2O2/c1-22-7-6-10-28(19-22)32(20-24-11-13-27(31)14-12-24)30(34)35-29-21-33(17-15-26(29)16-18-33)23(2)25-8-4-3-5-9-25/h3-14,19,23,26,29H,15-18,20-21H2,1-2H3/q+1/t23?,26?,29-,33?/m0/s1 |
| InChIKey | RLTSBJMJNSQRTG-OJXUELNUSA-N |
| XLogP | 6.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|