C28H33BrN2O2S — CID 172790307
[(3R)-1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-methylphenyl)-N-(thiophen-2-ylmethyl)carbamate bromide (PubChem CID 172790307) has the molecular formula C28H33BrN2O2S and a molecular weight of 541.56 g/mol. Its IUPAC name is [(3R)-1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-methylphenyl)-N-(thiophen-2-ylmethyl)carbamate bromide.
| Compound Name | [(3R)-1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-methylphenyl)-N-(thiophen-2-ylmethyl)carbamate bromide |
|---|---|
| PubChem CID | 172790307 |
| Molecular Formula | C28H33BrN2O2S |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | [(3R)-1-(1-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-(3-methylphenyl)-N-(thiophen-2-ylmethyl)carbamate bromide |
| SMILES | Cc1cccc(N(Cc2cccs2)C(=O)O[C@H]2C[N+]3(C(C)c4ccccc4)CCC2CC3)c1.[Br-] |
| InChI | InChI=1S/C28H33N2O2S.BrH/c1-21-8-6-11-25(18-21)29(19-26-12-7-17-33-26)28(31)32-27-20-30(15-13-24(27)14-16-30)22(2)23-9-4-3-5-10-23;/h3-12,17-18,22,24,27H,13-16,19-20H2,1-2H3;1H/q+1;/p-1/t22?,24?,27-,30?;/m0./s1 |
| InChIKey | PMAFWMHQTXJSSY-OICHVIOLSA-M |
| XLogP | 3.57 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|