C28H32Br2N2O2S — CID 159095905
[(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(5-bromothiophen-2-yl)methyl]-N-phenylcarbamate bromide (PubChem CID 159095905) has the molecular formula C28H32Br2N2O2S and a molecular weight of 620.45 g/mol. Its IUPAC name is [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(5-bromothiophen-2-yl)methyl]-N-phenylcarbamate bromide.
| Compound Name | [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(5-bromothiophen-2-yl)methyl]-N-phenylcarbamate bromide |
|---|---|
| PubChem CID | 159095905 |
| Molecular Formula | C28H32Br2N2O2S |
| Molecular Weight | 620.45 g/mol |
| Exact Mass | 618.06 |
| IUPAC Name | [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[(5-bromothiophen-2-yl)methyl]-N-phenylcarbamate bromide |
| SMILES | O=C(O[C@H]1C[N+]2(CCCc3ccccc3)CCC1CC2)N(Cc1ccc(Br)s1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C28H32BrN2O2S.BrH/c29-27-14-13-25(34-27)20-30(24-11-5-2-6-12-24)28(32)33-26-21-31(18-15-23(26)16-19-31)17-7-10-22-8-3-1-4-9-22;/h1-6,8-9,11-14,23,26H,7,10,15-21H2;1H/q+1;/p-1/t23?,26-,31?;/m0./s1 |
| InChIKey | KCQXBSWVFOZHCH-AOOWOONRSA-M |
| XLogP | 3.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|