C27H30BrN2O2S+ — CID 69278153
[1-(2-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[2-[(5-bromothiophen-2-yl)methyl]phenyl]carbamate (PubChem CID 69278153) has the molecular formula C27H30BrN2O2S+ and a molecular weight of 526.52 g/mol. Its IUPAC name is [1-(2-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[2-[(5-bromothiophen-2-yl)methyl]phenyl]carbamate.
| Compound Name | [1-(2-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[2-[(5-bromothiophen-2-yl)methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 69278153 |
| Molecular Formula | C27H30BrN2O2S+ |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | [1-(2-phenylethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-[2-[(5-bromothiophen-2-yl)methyl]phenyl]carbamate |
| SMILES | O=C(Nc1ccccc1Cc1ccc(Br)s1)OC1C[N+]2(CCc3ccccc3)CCC1CC2 |
| InChI | InChI=1S/C27H29BrN2O2S/c28-26-11-10-23(33-26)18-22-8-4-5-9-24(22)29-27(31)32-25-19-30(16-13-21(25)14-17-30)15-12-20-6-2-1-3-7-20/h1-11,21,25H,12-19H2/p+1 |
| InChIKey | YRZNUVSKJBBKJK-UHFFFAOYSA-O |
| XLogP | 6.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|