C31H42NO3+ — CID 53311181
[(3R)-1-[2-(2-phenylethoxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate (PubChem CID 53311181) has the molecular formula C31H42NO3+ and a molecular weight of 476.68 g/mol. Its IUPAC name is [(3R)-1-[2-(2-phenylethoxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate.
| Compound Name | [(3R)-1-[2-(2-phenylethoxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 53311181 |
| Molecular Formula | C31H42NO3+ |
| Molecular Weight | 476.68 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | [(3R)-1-[2-(2-phenylethoxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate |
| SMILES | O=C(O[C@H]1C[N+]2(CCOCCc3ccccc3)CCC1CC2)C1(c2ccccc2)CCCCCC1 |
| InChI | InChI=1S/C31H42NO3/c33-30(31(18-9-1-2-10-19-31)28-13-7-4-8-14-28)35-29-25-32(20-15-27(29)16-21-32)22-24-34-23-17-26-11-5-3-6-12-26/h3-8,11-14,27,29H,1-2,9-10,15-25H2/q+1/t27?,29-,32?/m0/s1 |
| InChIKey | WTHBMTUJGYRMGR-HAMJSAHASA-N |
| XLogP | 5.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.68 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|