C28H38NO3+ — CID 72545285
[(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 1-cyclopenta-1,3-dien-1-ylcycloheptane-1-carboxylate (PubChem CID 72545285) has the molecular formula C28H38NO3+ and a molecular weight of 436.62 g/mol. Its IUPAC name is [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 1-cyclopenta-1,3-dien-1-ylcycloheptane-1-carboxylate.
| Compound Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 1-cyclopenta-1,3-dien-1-ylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 72545285 |
| Molecular Formula | C28H38NO3+ |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | [(3R)-1-(2-phenoxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 1-cyclopenta-1,3-dien-1-ylcycloheptane-1-carboxylate |
| SMILES | O=C(O[C@H]1C[N+]2(CCOc3ccccc3)CCC1CC2)C1(C2=CC=CC2)CCCCCC1 |
| InChI | InChI=1S/C28H38NO3/c30-27(28(24-10-6-7-11-24)16-8-1-2-9-17-28)32-26-22-29(18-14-23(26)15-19-29)20-21-31-25-12-4-3-5-13-25/h3-7,10,12-13,23,26H,1-2,8-9,11,14-22H2/q+1/t23?,26-,29?/m0/s1 |
| InChIKey | ZQILZUIFOHLKHJ-JOMKWTIYSA-N |
| XLogP | 5.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|