C29H36ClN2O3+ — CID 44554374
[(3R)-1-(1,3-benzoxazol-2-ylmethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate;hydrochloride (PubChem CID 44554374) has the molecular formula C29H36ClN2O3+ and a molecular weight of 496.07 g/mol. Its IUPAC name is [(3R)-1-(1,3-benzoxazol-2-ylmethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate;hydrochloride.
| Compound Name | [(3R)-1-(1,3-benzoxazol-2-ylmethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 44554374 |
| Molecular Formula | C29H36ClN2O3+ |
| Molecular Weight | 496.07 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | [(3R)-1-(1,3-benzoxazol-2-ylmethyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate;hydrochloride |
| SMILES | Cl.O=C(O[C@H]1C[N+]2(Cc3nc4ccccc4o3)CCC1CC2)C1(c2ccccc2)CCCCCC1 |
| InChI | InChI=1S/C29H35N2O3.ClH/c32-28(29(16-8-1-2-9-17-29)23-10-4-3-5-11-23)34-26-20-31(18-14-22(26)15-19-31)21-27-30-24-12-6-7-13-25(24)33-27;/h3-7,10-13,22,26H,1-2,8-9,14-21H2;1H/q+1;/t22?,26-,31?;/m0./s1 |
| InChIKey | MZRHEHZBODHSJJ-VAXCQOKESA-N |
| XLogP | 6.19 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.07 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|