C30H32F3N2O2+ — CID 11721270
[(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-phenyl-N-[(2,4,5-trifluorophenyl)methyl]carbamate (PubChem CID 11721270) has the molecular formula C30H32F3N2O2+ and a molecular weight of 509.59 g/mol. Its IUPAC name is [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-phenyl-N-[(2,4,5-trifluorophenyl)methyl]carbamate.
| Compound Name | [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-phenyl-N-[(2,4,5-trifluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 11721270 |
| Molecular Formula | C30H32F3N2O2+ |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] N-phenyl-N-[(2,4,5-trifluorophenyl)methyl]carbamate |
| SMILES | O=C(O[C@H]1C[N+]2(CCCc3ccccc3)CCC1CC2)N(Cc1cc(F)c(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C30H32F3N2O2/c31-26-19-28(33)27(32)18-24(26)20-34(25-11-5-2-6-12-25)30(36)37-29-21-35(16-13-23(29)14-17-35)15-7-10-22-8-3-1-4-9-22/h1-6,8-9,11-12,18-19,23,29H,7,10,13-17,20-21H2/q+1/t23?,29-,35?/m0/s1 |
| InChIKey | JWZKAZQLBDSXDR-VOTUQHNOSA-N |
| XLogP | 6.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|