C29H28F3N2O3+ — CID 87763752
(1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) N-[(3,4-difluorophenyl)methyl]-N-(2-fluorophenyl)carbamate (PubChem CID 87763752) has the molecular formula C29H28F3N2O3+ and a molecular weight of 509.55 g/mol. Its IUPAC name is (1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) N-[(3,4-difluorophenyl)methyl]-N-(2-fluorophenyl)carbamate.
| Compound Name | (1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) N-[(3,4-difluorophenyl)methyl]-N-(2-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 87763752 |
| Molecular Formula | C29H28F3N2O3+ |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | (1-phenacyl-1-azoniabicyclo[2.2.2]octan-3-yl) N-[(3,4-difluorophenyl)methyl]-N-(2-fluorophenyl)carbamate |
| SMILES | O=C(C[N+]12CCC(CC1)C(OC(=O)N(Cc1ccc(F)c(F)c1)c1ccccc1F)C2)c1ccccc1 |
| InChI | InChI=1S/C29H28F3N2O3/c30-23-11-10-20(16-25(23)32)17-33(26-9-5-4-8-24(26)31)29(36)37-28-19-34(14-12-22(28)13-15-34)18-27(35)21-6-2-1-3-7-21/h1-11,16,22,28H,12-15,17-19H2/q+1 |
| InChIKey | WKBGOUZBYKGASN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|