C30H31F2N2O4S+ — CID 87762950
S-(2-methoxyphenyl) 2-[3-[(2-fluorophenyl)-[(4-fluorophenyl)methyl]carbamoyl]oxy-1-azoniabicyclo[2.2.2]octan-1-yl]ethanethioate (PubChem CID 87762950) has the molecular formula C30H31F2N2O4S+ and a molecular weight of 553.65 g/mol. Its IUPAC name is S-(2-methoxyphenyl) 2-[3-[(2-fluorophenyl)-[(4-fluorophenyl)methyl]carbamoyl]oxy-1-azoniabicyclo[2.2.2]octan-1-yl]ethanethioate.
| Compound Name | S-(2-methoxyphenyl) 2-[3-[(2-fluorophenyl)-[(4-fluorophenyl)methyl]carbamoyl]oxy-1-azoniabicyclo[2.2.2]octan-1-yl]ethanethioate |
|---|---|
| PubChem CID | 87762950 |
| Molecular Formula | C30H31F2N2O4S+ |
| Molecular Weight | 553.65 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | S-(2-methoxyphenyl) 2-[3-[(2-fluorophenyl)-[(4-fluorophenyl)methyl]carbamoyl]oxy-1-azoniabicyclo[2.2.2]octan-1-yl]ethanethioate |
| SMILES | COc1ccccc1SC(=O)C[N+]12CCC(CC1)C(OC(=O)N(Cc1ccc(F)cc1)c1ccccc1F)C2 |
| InChI | InChI=1S/C30H31F2N2O4S/c1-37-26-8-4-5-9-28(26)39-29(35)20-34-16-14-22(15-17-34)27(19-34)38-30(36)33(25-7-3-2-6-24(25)32)18-21-10-12-23(31)13-11-21/h2-13,22,27H,14-20H2,1H3/q+1 |
| InChIKey | DXIHPCGDQYJOCJ-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.65 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|