C26H28N4O4 — CID 11655543
2-[(1R)-1-methyl-1-[2-oxo-2-(pyridazin-3-ylamino)ethyl]piperidin-1-ium-3-yl]oxy-2-oxo-1,1-diphenylethanolate (PubChem CID 11655543) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is 2-[(1R)-1-methyl-1-[2-oxo-2-(pyridazin-3-ylamino)ethyl]piperidin-1-ium-3-yl]oxy-2-oxo-1,1-diphenylethanolate.
| Compound Name | 2-[(1R)-1-methyl-1-[2-oxo-2-(pyridazin-3-ylamino)ethyl]piperidin-1-ium-3-yl]oxy-2-oxo-1,1-diphenylethanolate |
|---|---|
| PubChem CID | 11655543 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 2-[(1R)-1-methyl-1-[2-oxo-2-(pyridazin-3-ylamino)ethyl]piperidin-1-ium-3-yl]oxy-2-oxo-1,1-diphenylethanolate |
| SMILES | C[N@@+]1(CC(=O)Nc2cccnn2)CCCC(OC(=O)C([O-])(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C26H28N4O4/c1-30(19-24(31)28-23-15-8-16-27-29-23)17-9-14-22(18-30)34-25(32)26(33,20-10-4-2-5-11-20)21-12-6-3-7-13-21/h2-8,10-13,15-16,22H,9,14,17-19H2,1H3,(H,28,29,31)/t22?,30-/m1/s1 |
| InChIKey | RRUGNBBOXQNTHS-GEFZVGADSA-N |
| XLogP | 1.87 |
| TPSA | 104.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|