C31H42NO4+ — CID 69478560
[(3R)-1-methyl-1-[3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propyl]pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate (PubChem CID 69478560) has the molecular formula C31H42NO4+ and a molecular weight of 492.68 g/mol. Its IUPAC name is [(3R)-1-methyl-1-[3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propyl]pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate.
| Compound Name | [(3R)-1-methyl-1-[3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propyl]pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 69478560 |
| Molecular Formula | C31H42NO4+ |
| Molecular Weight | 492.68 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | [(3R)-1-methyl-1-[3-(5,6,7,8-tetrahydronaphthalen-2-yloxy)propyl]pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
| SMILES | C[N+]1(CCCOc2ccc3c(c2)CCCC3)CC[C@@H](OC(=O)[C@](O)(c2ccccc2)C2CCCC2)C1 |
| InChI | InChI=1S/C31H42NO4/c1-32(19-9-21-35-28-17-16-24-10-5-6-11-25(24)22-28)20-18-29(23-32)36-30(33)31(34,27-14-7-8-15-27)26-12-3-2-4-13-26/h2-4,12-13,16-17,22,27,29,34H,5-11,14-15,18-21,23H2,1H3/q+1/t29-,31+,32?/m1/s1 |
| InChIKey | YLGCBNRRWMQFHU-HKNZYLRQSA-N |
| XLogP | 5.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.68 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|