C13H25N2O3+ — CID 158103107
(8-methyl-8-aza-5-azoniaspiro[4.5]decan-3-yl) 2-hydroxy-2-methylpropanoate (PubChem CID 158103107) has the molecular formula C13H25N2O3+ and a molecular weight of 257.35 g/mol. Its IUPAC name is (8-methyl-8-aza-5-azoniaspiro[4.5]decan-3-yl) 2-hydroxy-2-methylpropanoate.
| Compound Name | (8-methyl-8-aza-5-azoniaspiro[4.5]decan-3-yl) 2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 158103107 |
| Molecular Formula | C13H25N2O3+ |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | (8-methyl-8-aza-5-azoniaspiro[4.5]decan-3-yl) 2-hydroxy-2-methylpropanoate |
| SMILES | CN1CC[N+]2(CCC(OC(=O)C(C)(C)O)C2)CC1 |
| InChI | InChI=1S/C13H25N2O3/c1-13(2,17)12(16)18-11-4-7-15(10-11)8-5-14(3)6-9-15/h11,17H,4-10H2,1-3H3/q+1 |
| InChIKey | VOHUHWCFYAGCGD-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|