C20H31BrN2O3S — CID 11753939
2-cyclopentyl-2-hydroxy-N-[(3R)-1-(2-hydroxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl]-2-thiophen-2-ylacetamide bromide (PubChem CID 11753939) has the molecular formula C20H31BrN2O3S and a molecular weight of 459.45 g/mol. Its IUPAC name is 2-cyclopentyl-2-hydroxy-N-[(3R)-1-(2-hydroxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl]-2-thiophen-2-ylacetamide bromide.
| Compound Name | 2-cyclopentyl-2-hydroxy-N-[(3R)-1-(2-hydroxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl]-2-thiophen-2-ylacetamide bromide |
|---|---|
| PubChem CID | 11753939 |
| Molecular Formula | C20H31BrN2O3S |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 2-cyclopentyl-2-hydroxy-N-[(3R)-1-(2-hydroxyethyl)-1-azoniabicyclo[2.2.2]octan-3-yl]-2-thiophen-2-ylacetamide bromide |
| SMILES | O=C(N[C@H]1C[N+]2(CCO)CCC1CC2)C(O)(c1cccs1)C1CCCC1.[Br-] |
| InChI | InChI=1S/C20H30N2O3S.BrH/c23-12-11-22-9-7-15(8-10-22)17(14-22)21-19(24)20(25,16-4-1-2-5-16)18-6-3-13-26-18;/h3,6,13,15-17,23,25H,1-2,4-5,7-12,14H2;1H/t15?,17-,20?,22?;/m0./s1 |
| InChIKey | XWNUNLUWUXNGAR-MHMPHQATSA-N |
| XLogP | -1.15 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|