C30H41BrN2O3 — CID 69090237
[(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(2,2-dimethylazetidin-1-yl)-2-phenylpropanoate bromide (PubChem CID 69090237) has the molecular formula C30H41BrN2O3 and a molecular weight of 557.57 g/mol. Its IUPAC name is [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(2,2-dimethylazetidin-1-yl)-2-phenylpropanoate bromide.
| Compound Name | [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(2,2-dimethylazetidin-1-yl)-2-phenylpropanoate bromide |
|---|---|
| PubChem CID | 69090237 |
| Molecular Formula | C30H41BrN2O3 |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | [(3R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(2,2-dimethylazetidin-1-yl)-2-phenylpropanoate bromide |
| SMILES | CC1(C)CCN1C(C)(C(=O)O[C@H]1C[N+]2(CCCOc3ccccc3)CCC1CC2)c1ccccc1.[Br-] |
| InChI | InChI=1S/C30H41N2O3.BrH/c1-29(2)17-18-31(29)30(3,25-11-6-4-7-12-25)28(33)35-27-23-32(20-15-24(27)16-21-32)19-10-22-34-26-13-8-5-9-14-26;/h4-9,11-14,24,27H,10,15-23H2,1-3H3;1H/q+1;/p-1/t24?,27-,30?,32?;/m0./s1 |
| InChIKey | JTQZQCNNAOKNKN-QVBXJKLASA-M |
| XLogP | 2.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|