C23H37N2O4+ — CID 18456753
[(3R)-1-[2-(2-methoxyethoxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-butyl-N-phenylcarbamate (PubChem CID 18456753) has the molecular formula C23H37N2O4+ and a molecular weight of 405.56 g/mol. Its IUPAC name is [(3R)-1-[2-(2-methoxyethoxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-butyl-N-phenylcarbamate.
| Compound Name | [(3R)-1-[2-(2-methoxyethoxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-butyl-N-phenylcarbamate |
|---|---|
| PubChem CID | 18456753 |
| Molecular Formula | C23H37N2O4+ |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | [(3R)-1-[2-(2-methoxyethoxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] N-butyl-N-phenylcarbamate |
| SMILES | CCCCN(C(=O)O[C@H]1C[N+]2(CCOCCOC)CCC1CC2)c1ccccc1 |
| InChI | InChI=1S/C23H37N2O4/c1-3-4-12-24(21-8-6-5-7-9-21)23(26)29-22-19-25(13-10-20(22)11-14-25)15-16-28-18-17-27-2/h5-9,20,22H,3-4,10-19H2,1-2H3/q+1/t20?,22-,25?/m0/s1 |
| InChIKey | SAQHUZWTXIFWGY-CVCZCXRASA-N |
| XLogP | 3.70 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|