C25H41N2O2+ — CID 150822716
[(2R)-1-heptyl-1-azoniabicyclo[2.2.2]octan-2-yl] N-butyl-N-phenylcarbamate (PubChem CID 150822716) has the molecular formula C25H41N2O2+ and a molecular weight of 401.62 g/mol. Its IUPAC name is [(2R)-1-heptyl-1-azoniabicyclo[2.2.2]octan-2-yl] N-butyl-N-phenylcarbamate.
| Compound Name | [(2R)-1-heptyl-1-azoniabicyclo[2.2.2]octan-2-yl] N-butyl-N-phenylcarbamate |
|---|---|
| PubChem CID | 150822716 |
| Molecular Formula | C25H41N2O2+ |
| Molecular Weight | 401.62 g/mol |
| Exact Mass | 401.32 |
| IUPAC Name | [(2R)-1-heptyl-1-azoniabicyclo[2.2.2]octan-2-yl] N-butyl-N-phenylcarbamate |
| SMILES | CCCCCCC[N+]12CCC(CC1)C[C@H]2OC(=O)N(CCCC)c1ccccc1 |
| InChI | InChI=1S/C25H41N2O2/c1-3-5-7-8-12-18-27-19-15-22(16-20-27)21-24(27)29-25(28)26(17-6-4-2)23-13-10-9-11-14-23/h9-11,13-14,22,24H,3-8,12,15-21H2,1-2H3/q+1/t22?,24-,27?/m1/s1 |
| InChIKey | KKGYEMWHVFYGSH-AFCFIKFXSA-N |
| XLogP | 6.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.62 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|