C27H35N2O2+ — CID 90708881
[1-(4-methylpent-3-enyl)-1-azoniabicyclo[2.2.2]octan-2-yl] N-benzyl-N-phenylcarbamate (PubChem CID 90708881) has the molecular formula C27H35N2O2+ and a molecular weight of 419.59 g/mol. Its IUPAC name is [1-(4-methylpent-3-enyl)-1-azoniabicyclo[2.2.2]octan-2-yl] N-benzyl-N-phenylcarbamate.
| Compound Name | [1-(4-methylpent-3-enyl)-1-azoniabicyclo[2.2.2]octan-2-yl] N-benzyl-N-phenylcarbamate |
|---|---|
| PubChem CID | 90708881 |
| Molecular Formula | C27H35N2O2+ |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | [1-(4-methylpent-3-enyl)-1-azoniabicyclo[2.2.2]octan-2-yl] N-benzyl-N-phenylcarbamate |
| SMILES | CC(C)=CCC[N+]12CCC(CC1)CC2OC(=O)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H35N2O2/c1-22(2)10-9-17-29-18-15-23(16-19-29)20-26(29)31-27(30)28(25-13-7-4-8-14-25)21-24-11-5-3-6-12-24/h3-8,10-14,23,26H,9,15-21H2,1-2H3/q+1 |
| InChIKey | PMHAKWPGGMAQOD-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|