C28H39N2O2+ — CID 90711320
7-(1-azoniabicyclo[2.2.2]octan-1-yl)heptyl N-benzyl-N-phenylcarbamate (PubChem CID 90711320) has the molecular formula C28H39N2O2+ and a molecular weight of 435.63 g/mol. Its IUPAC name is 7-(1-azoniabicyclo[2.2.2]octan-1-yl)heptyl N-benzyl-N-phenylcarbamate.
| Compound Name | 7-(1-azoniabicyclo[2.2.2]octan-1-yl)heptyl N-benzyl-N-phenylcarbamate |
|---|---|
| PubChem CID | 90711320 |
| Molecular Formula | C28H39N2O2+ |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.30 |
| IUPAC Name | 7-(1-azoniabicyclo[2.2.2]octan-1-yl)heptyl N-benzyl-N-phenylcarbamate |
| SMILES | O=C(OCCCCCCC[N+]12CCC(CC1)CC2)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H39N2O2/c31-28(29(27-14-8-5-9-15-27)24-26-12-6-4-7-13-26)32-23-11-3-1-2-10-19-30-20-16-25(17-21-30)18-22-30/h4-9,12-15,25H,1-3,10-11,16-24H2/q+1 |
| InChIKey | JANZSEGWVMEZFN-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|