C26H41N2O2+ — CID 10279886
[(3R)-1-heptyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-pent-4-enyl-N-phenylcarbamate (PubChem CID 10279886) has the molecular formula C26H41N2O2+ and a molecular weight of 413.63 g/mol. Its IUPAC name is [(3R)-1-heptyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-pent-4-enyl-N-phenylcarbamate.
| Compound Name | [(3R)-1-heptyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-pent-4-enyl-N-phenylcarbamate |
|---|---|
| PubChem CID | 10279886 |
| Molecular Formula | C26H41N2O2+ |
| Molecular Weight | 413.63 g/mol |
| Exact Mass | 413.32 |
| IUPAC Name | [(3R)-1-heptyl-1-azoniabicyclo[2.2.2]octan-3-yl] N-pent-4-enyl-N-phenylcarbamate |
| SMILES | C=CCCCN(C(=O)O[C@H]1C[N+]2(CCCCCCC)CCC1CC2)c1ccccc1 |
| InChI | InChI=1S/C26H41N2O2/c1-3-5-7-8-13-19-28-20-16-23(17-21-28)25(22-28)30-26(29)27(18-12-6-4-2)24-14-10-9-11-15-24/h4,9-11,14-15,23,25H,2-3,5-8,12-13,16-22H2,1H3/q+1/t23?,25-,28?/m0/s1 |
| InChIKey | LMDUVRPXNAFSFL-RXFKJLCSSA-N |
| XLogP | 6.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.63 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|