C31H34BrNO3 — CID 159400750
[(2R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-2-yl] 9,10-dihydroanthracene-9-carboxylate bromide (PubChem CID 159400750) has the molecular formula C31H34BrNO3 and a molecular weight of 548.52 g/mol. Its IUPAC name is [(2R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-2-yl] 9,10-dihydroanthracene-9-carboxylate bromide.
| Compound Name | [(2R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-2-yl] 9,10-dihydroanthracene-9-carboxylate bromide |
|---|---|
| PubChem CID | 159400750 |
| Molecular Formula | C31H34BrNO3 |
| Molecular Weight | 548.52 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | [(2R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-2-yl] 9,10-dihydroanthracene-9-carboxylate bromide |
| SMILES | O=C(O[C@@H]1CC2CC[N+]1(CCCOc1ccccc1)CC2)C1c2ccccc2Cc2ccccc21.[Br-] |
| InChI | InChI=1S/C31H34NO3.BrH/c33-31(30-27-13-6-4-9-24(27)22-25-10-5-7-14-28(25)30)35-29-21-23-15-18-32(29,19-16-23)17-8-20-34-26-11-2-1-3-12-26;/h1-7,9-14,23,29-30H,8,15-22H2;1H/q+1;/p-1/t23?,29-,32?;/m1./s1 |
| InChIKey | LNHQJIPBQQSVHD-IGARGKKFSA-M |
| XLogP | 2.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|