C32H38NO4+ — CID 154068864
[(2R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-2-yl] 2-hydroxy-2,2-bis(4-methylphenyl)acetate (PubChem CID 154068864) has the molecular formula C32H38NO4+ and a molecular weight of 500.66 g/mol. Its IUPAC name is [(2R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-2-yl] 2-hydroxy-2,2-bis(4-methylphenyl)acetate.
| Compound Name | [(2R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-2-yl] 2-hydroxy-2,2-bis(4-methylphenyl)acetate |
|---|---|
| PubChem CID | 154068864 |
| Molecular Formula | C32H38NO4+ |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | [(2R)-1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-2-yl] 2-hydroxy-2,2-bis(4-methylphenyl)acetate |
| SMILES | Cc1ccc(C(O)(C(=O)O[C@@H]2CC3CC[N+]2(CCCOc2ccccc2)CC3)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H38NO4/c1-24-9-13-27(14-10-24)32(35,28-15-11-25(2)12-16-28)31(34)37-30-23-26-17-20-33(30,21-18-26)19-6-22-36-29-7-4-3-5-8-29/h3-5,7-16,26,30,35H,6,17-23H2,1-2H3/q+1/t26?,30-,33?/m1/s1 |
| InChIKey | RTVRYZFXXPZMJP-SRCXMTRWSA-N |
| XLogP | 5.51 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|