C23H26NO3S3+ — CID 69459268
[(2R)-1-(2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-2-yl] 2-hydroxy-2,2-di(thiophen-3-yl)acetate (PubChem CID 69459268) has the molecular formula C23H26NO3S3+ and a molecular weight of 460.67 g/mol. Its IUPAC name is [(2R)-1-(2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-2-yl] 2-hydroxy-2,2-di(thiophen-3-yl)acetate.
| Compound Name | [(2R)-1-(2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-2-yl] 2-hydroxy-2,2-di(thiophen-3-yl)acetate |
|---|---|
| PubChem CID | 69459268 |
| Molecular Formula | C23H26NO3S3+ |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | [(2R)-1-(2-thiophen-2-ylethyl)-1-azoniabicyclo[2.2.2]octan-2-yl] 2-hydroxy-2,2-di(thiophen-3-yl)acetate |
| SMILES | O=C(O[C@@H]1CC2CC[N+]1(CCc1cccs1)CC2)C(O)(c1ccsc1)c1ccsc1 |
| InChI | InChI=1S/C23H26NO3S3/c25-22(23(26,18-6-12-28-15-18)19-7-13-29-16-19)27-21-14-17-3-8-24(21,9-4-17)10-5-20-2-1-11-30-20/h1-2,6-7,11-13,15-17,21,26H,3-5,8-10,14H2/q+1/t17?,21-,24?/m1/s1 |
| InChIKey | CUGDKAOYRQVMRL-SSSUMRQXSA-N |
| XLogP | 4.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|