C26H30NO3S2+ — CID 154068845
[(2R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-2-yl] 2-hydroxy-2,2-di(thiophen-3-yl)acetate (PubChem CID 154068845) has the molecular formula C26H30NO3S2+ and a molecular weight of 468.66 g/mol. Its IUPAC name is [(2R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-2-yl] 2-hydroxy-2,2-di(thiophen-3-yl)acetate.
| Compound Name | [(2R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-2-yl] 2-hydroxy-2,2-di(thiophen-3-yl)acetate |
|---|---|
| PubChem CID | 154068845 |
| Molecular Formula | C26H30NO3S2+ |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | [(2R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-2-yl] 2-hydroxy-2,2-di(thiophen-3-yl)acetate |
| SMILES | O=C(O[C@@H]1CC2CC[N+]1(CCCc1ccccc1)CC2)C(O)(c1ccsc1)c1ccsc1 |
| InChI | InChI=1S/C26H30NO3S2/c28-25(26(29,22-10-15-31-18-22)23-11-16-32-19-23)30-24-17-21-8-13-27(24,14-9-21)12-4-7-20-5-2-1-3-6-20/h1-3,5-6,10-11,15-16,18-19,21,24,29H,4,7-9,12-14,17H2/q+1/t21?,24-,27?/m1/s1 |
| InChIKey | HKHNSBQVQRJJAC-DSYMUFTKSA-N |
| XLogP | 5.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|