C29H36NO5S2+ — CID 154068854
[(2R)-1-[3-[4-(3-hydroxypropyl)phenoxy]propyl]-1-azoniabicyclo[2.2.2]octan-2-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 154068854) has the molecular formula C29H36NO5S2+ and a molecular weight of 542.74 g/mol. Its IUPAC name is [(2R)-1-[3-[4-(3-hydroxypropyl)phenoxy]propyl]-1-azoniabicyclo[2.2.2]octan-2-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [(2R)-1-[3-[4-(3-hydroxypropyl)phenoxy]propyl]-1-azoniabicyclo[2.2.2]octan-2-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 154068854 |
| Molecular Formula | C29H36NO5S2+ |
| Molecular Weight | 542.74 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | [(2R)-1-[3-[4-(3-hydroxypropyl)phenoxy]propyl]-1-azoniabicyclo[2.2.2]octan-2-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | O=C(O[C@@H]1CC2CC[N+]1(CCCOc1ccc(CCCO)cc1)CC2)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C29H36NO5S2/c31-17-1-5-22-8-10-24(11-9-22)34-18-4-14-30-15-12-23(13-16-30)21-27(30)35-28(32)29(33,25-6-2-19-36-25)26-7-3-20-37-26/h2-3,6-11,19-20,23,27,31,33H,1,4-5,12-18,21H2/q+1/t23?,27-,30?/m1/s1 |
| InChIKey | COFZWORWHOBFRV-DLPZQXBVSA-N |
| XLogP | 4.94 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.74 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|