C66H78N6O12S2 — CID 142706312
naphthalene-1,5-disulfonate;bis([(3R)-1-[2-oxo-2-(pyridin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate) (PubChem CID 142706312) has the molecular formula C66H78N6O12S2 and a molecular weight of 1211.51 g/mol. Its IUPAC name is naphthalene-1,5-disulfonate;bis([(3R)-1-[2-oxo-2-(pyridin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate).
| Compound Name | naphthalene-1,5-disulfonate;bis([(3R)-1-[2-oxo-2-(pyridin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate) |
|---|---|
| PubChem CID | 142706312 |
| Molecular Formula | C66H78N6O12S2 |
| Molecular Weight | 1211.51 g/mol |
| Exact Mass | 1210.51 |
| IUPAC Name | naphthalene-1,5-disulfonate;bis([(3R)-1-[2-oxo-2-(pyridin-2-ylamino)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 1-phenylcycloheptane-1-carboxylate) |
| SMILES | O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C1(c3ccccc3)CCCCCC1)C2)Nc1ccccn1.O=C(C[N+]12CCC(CC1)[C@@H](OC(=O)C1(c3ccccc3)CCCCCC1)C2)Nc1ccccn1.O=S(=O)([O-])c1cccc2c(S(=O)(=O)[O-])cccc12 |
| InChI | InChI=1S/2C28H35N3O3.C10H8O6S2/c2*32-26(30-25-12-6-9-17-29-25)21-31-18-13-22(14-19-31)24(20-31)34-27(33)28(15-7-1-2-8-16-28)23-10-4-3-5-11-23;11-17(12,13)9-5-1-3-7-8(9)4-2-6-10(7)18(14,15)16/h2*3-6,9-12,17,22,24H,1-2,7-8,13-16,18-21H2;1-6H,(H,11,12,13)(H,14,15,16)/t2*22?,24-,31?;/m00./s1 |
| InChIKey | RJOWSPKRYQXKDN-VQSGRXHFSA-N |
| XLogP | 9.58 |
| TPSA | 250.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 86 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1211.51 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|