C13H20ClNO3 — CID 44658795
1-piperidin-1-ium-1-ylpropan-2-yl furan-2-carboxylate chloride (PubChem CID 44658795) has the molecular formula C13H20ClNO3 and a molecular weight of 273.76 g/mol. Its IUPAC name is 1-piperidin-1-ium-1-ylpropan-2-yl furan-2-carboxylate chloride.
| Compound Name | 1-piperidin-1-ium-1-ylpropan-2-yl furan-2-carboxylate chloride |
|---|---|
| PubChem CID | 44658795 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 1-piperidin-1-ium-1-ylpropan-2-yl furan-2-carboxylate chloride |
| SMILES | CC(C[NH+]1CCCCC1)OC(=O)c1ccco1.[Cl-] |
| InChI | InChI=1S/C13H19NO3.ClH/c1-11(10-14-7-3-2-4-8-14)17-13(15)12-6-5-9-16-12;/h5-6,9,11H,2-4,7-8,10H2,1H3;1H |
| InChIKey | LDWIIQLNSZATKH-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 43.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |