C14H19NO4 — CID 1469985
[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] furan-2-carboxylate (PubChem CID 1469985) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is [(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] furan-2-carboxylate.
| Compound Name | [(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 1469985 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | [(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] furan-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1ccco1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H19NO4/c1-10(19-14(17)12-8-5-9-18-12)13(16)15-11-6-3-2-4-7-11/h5,8-11H,2-4,6-7H2,1H3,(H,15,16)/t10-/m1/s1 |
| InChIKey | AALAMDHRAXQYQW-SNVBAGLBSA-N |
| XLogP | 2.27 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |