About 1-(4-methylpiperazin-1-ium-1-yl)propan-2-yl 4-ethoxybenzoate chloride
1-(4-methylpiperazin-1-ium-1-yl)propan-2-yl 4-ethoxybenzoate chloride (PubChem CID 44662842) has the molecular formula C17H27ClN2O3
and a molecular weight of 342.87 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-ium-1-yl)propan-2-yl 4-ethoxybenzoate chloride.
Molecular Properties
| Compound Name | 1-(4-methylpiperazin-1-ium-1-yl)propan-2-yl 4-ethoxybenzoate chloride |
| PubChem CID | 44662842 |
| Molecular Formula | C17H27ClN2O3 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-(4-methylpiperazin-1-ium-1-yl)propan-2-yl 4-ethoxybenzoate chloride |
| SMILES | CCOc1ccc(C(=O)OC(C)C[NH+]2CCN(C)CC2)cc1.[Cl-] |
| InChI | InChI=1S/C17H26N2O3.ClH/c1-4-21-16-7-5-15(6-8-16)17(20)22-14(2)13-19-11-9-18(3)10-12-19;/h5-8,14H,4,9-13H2,1-3H3;1H |
| InChIKey | LBPOLEQLTOBWBL-UHFFFAOYSA-N |
| XLogP | -2.54 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-methylpiperazin-1-ium-1-yl)propan-2-yl 4-ethoxybenzoate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylpiperazin-1-ium-1-yl)propan-2-yl 4-ethoxybenzoate chloride?
The IUPAC name of 1-(4-methylpiperazin-1-ium-1-yl)propan-2-yl 4-ethoxybenzoate chloride (CID 44662842) is 1-(4-methylpiperazin-1-ium-1-yl)propan-2-yl 4-ethoxybenzoate chloride.
What is the SMILES notation for 1-(4-methylpiperazin-1-ium-1-yl)propan-2-yl 4-ethoxybenzoate chloride?
The canonical SMILES for 1-(4-methylpiperazin-1-ium-1-yl)propan-2-yl 4-ethoxybenzoate chloride is CCOc1ccc(C(=O)OC(C)C[NH+]2CCN(C)CC2)cc1.[Cl-].
What is the InChIKey of 1-(4-methylpiperazin-1-ium-1-yl)propan-2-yl 4-ethoxybenzoate chloride?
The InChIKey is LBPOLEQLTOBWBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O3.ClH/c1-4-21-16-7-5-15(6-8-16)17(20)22-14(2)13-19-11-9-18(3)10-12-19;/h5-8,14H,4,9-13H2,1-3H3;1H.
What are the key properties of 1-(4-methylpiperazin-1-ium-1-yl)propan-2-yl 4-ethoxybenzoate chloride?
1-(4-methylpiperazin-1-ium-1-yl)propan-2-yl 4-ethoxybenzoate chloride has a molecular weight of 342.87 g/mol, XLogP of -2.54, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylpiperazin-1-ium-1-yl)propan-2-yl 4-ethoxybenzoate chloride is sourced from PubChem (CID 44662842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).