C17H24ClNO2 — CID 4139253
1-(2,6-dimethylpiperidin-1-yl)propan-2-yl 2-chlorobenzoate (PubChem CID 4139253) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is 1-(2,6-dimethylpiperidin-1-yl)propan-2-yl 2-chlorobenzoate.
| Compound Name | 1-(2,6-dimethylpiperidin-1-yl)propan-2-yl 2-chlorobenzoate |
|---|---|
| PubChem CID | 4139253 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 1-(2,6-dimethylpiperidin-1-yl)propan-2-yl 2-chlorobenzoate |
| SMILES | CC(CN1C(C)CCCC1C)OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H24ClNO2/c1-12-7-6-8-13(2)19(12)11-14(3)21-17(20)15-9-4-5-10-16(15)18/h4-5,9-10,12-14H,6-8,11H2,1-3H3 |
| InChIKey | UZHMQBMKYWOFAJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |