C31H41Cl2NO4 — CID 3063832
2-[bis(2-chloroethyl)aminomethyl]-4-methylidene-1,5-bis[4-(2-methylpropoxy)phenyl]pentane-1,5-dione (PubChem CID 3063832) has the molecular formula C31H41Cl2NO4 and a molecular weight of 562.58 g/mol. Its IUPAC name is 2-[bis(2-chloroethyl)aminomethyl]-4-methylidene-1,5-bis[4-(2-methylpropoxy)phenyl]pentane-1,5-dione.
| Compound Name | 2-[bis(2-chloroethyl)aminomethyl]-4-methylidene-1,5-bis[4-(2-methylpropoxy)phenyl]pentane-1,5-dione |
|---|---|
| PubChem CID | 3063832 |
| Molecular Formula | C31H41Cl2NO4 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | 2-[bis(2-chloroethyl)aminomethyl]-4-methylidene-1,5-bis[4-(2-methylpropoxy)phenyl]pentane-1,5-dione |
| SMILES | C=C(CC(CN(CCCl)CCCl)C(=O)c1ccc(OCC(C)C)cc1)C(=O)c1ccc(OCC(C)C)cc1 |
| InChI | InChI=1S/C31H41Cl2NO4/c1-22(2)20-37-28-10-6-25(7-11-28)30(35)24(5)18-27(19-34(16-14-32)17-15-33)31(36)26-8-12-29(13-9-26)38-21-23(3)4/h6-13,22-23,27H,5,14-21H2,1-4H3 |
| InChIKey | DENXVAVMNLUOKM-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|