C22H29N2OS+ — CID 2326065
N-[(1S,2S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]-3-phenylpropanethioamide (PubChem CID 2326065) has the molecular formula C22H29N2OS+ and a molecular weight of 369.55 g/mol. Its IUPAC name is N-[(1S,2S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]-3-phenylpropanethioamide.
| Compound Name | N-[(1S,2S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]-3-phenylpropanethioamide |
|---|---|
| PubChem CID | 2326065 |
| Molecular Formula | C22H29N2OS+ |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | N-[(1S,2S)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]-3-phenylpropanethioamide |
| SMILES | C[C@H](NC(=S)CCc1ccccc1)[C@H](c1ccccc1)[NH+]1CCOCC1 |
| InChI | InChI=1S/C22H28N2OS/c1-18(23-21(26)13-12-19-8-4-2-5-9-19)22(20-10-6-3-7-11-20)24-14-16-25-17-15-24/h2-11,18,22H,12-17H2,1H3,(H,23,26)/p+1/t18-,22+/m0/s1 |
| InChIKey | STUGGEMQWKTUDZ-PGRDOPGGSA-O |
| XLogP | 2.58 |
| TPSA | 25.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|