C21H27FN3OS+ — CID 8684247
1-(4-ethylphenyl)-3-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]thiourea (PubChem CID 8684247) has the molecular formula C21H27FN3OS+ and a molecular weight of 388.53 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]thiourea.
| Compound Name | 1-(4-ethylphenyl)-3-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]thiourea |
|---|---|
| PubChem CID | 8684247 |
| Molecular Formula | C21H27FN3OS+ |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 1-(4-ethylphenyl)-3-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]thiourea |
| SMILES | CCc1ccc(NC(=S)NC[C@H](c2ccc(F)cc2)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C21H26FN3OS/c1-2-16-3-9-19(10-4-16)24-21(27)23-15-20(25-11-13-26-14-12-25)17-5-7-18(22)8-6-17/h3-10,20H,2,11-15H2,1H3,(H2,23,24,27)/p+1/t20-/m1/s1 |
| InChIKey | IIYNLHXPOQRYMG-HXUWFJFHSA-O |
| XLogP | 2.33 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|