C20H25FN3O2S+ — CID 8684221
1-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]-3-(3-methoxyphenyl)thiourea (PubChem CID 8684221) has the molecular formula C20H25FN3O2S+ and a molecular weight of 390.50 g/mol. Its IUPAC name is 1-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 8684221 |
| Molecular Formula | C20H25FN3O2S+ |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)NC[C@@H](c2ccc(F)cc2)[NH+]2CCOCC2)c1 |
| InChI | InChI=1S/C20H24FN3O2S/c1-25-18-4-2-3-17(13-18)23-20(27)22-14-19(24-9-11-26-12-10-24)15-5-7-16(21)8-6-15/h2-8,13,19H,9-12,14H2,1H3,(H2,22,23,27)/p+1/t19-/m0/s1 |
| InChIKey | LBLVDBPMORLZDI-IBGZPJMESA-O |
| XLogP | 1.78 |
| TPSA | 46.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|