C22H30N3OS+ — CID 8681802
1-(3,5-dimethylphenyl)-3-[(2S)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]thiourea (PubChem CID 8681802) has the molecular formula C22H30N3OS+ and a molecular weight of 384.57 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[(2S)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[(2S)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]thiourea |
|---|---|
| PubChem CID | 8681802 |
| Molecular Formula | C22H30N3OS+ |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[(2S)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]thiourea |
| SMILES | COc1ccc([C@@H](CNC(=S)Nc2cc(C)cc(C)c2)[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C22H29N3OS/c1-16-12-17(2)14-19(13-16)24-22(27)23-15-21(25-10-4-5-11-25)18-6-8-20(26-3)9-7-18/h6-9,12-14,21H,4-5,10-11,15H2,1-3H3,(H2,23,24,27)/p+1/t21-/m1/s1 |
| InChIKey | YVVUUONKQWUEBY-OAQYLSRUSA-O |
| XLogP | 3.02 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|