C21H28N3O2S+ — CID 2455793
1-(3-methoxyphenyl)-3-[(2S)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]thiourea (PubChem CID 2455793) has the molecular formula C21H28N3O2S+ and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-[(2S)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]thiourea.
| Compound Name | 1-(3-methoxyphenyl)-3-[(2S)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]thiourea |
|---|---|
| PubChem CID | 2455793 |
| Molecular Formula | C21H28N3O2S+ |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-[(2S)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]thiourea |
| SMILES | COc1ccc([C@@H](CNC(=S)Nc2cccc(OC)c2)[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C21H27N3O2S/c1-25-18-10-8-16(9-11-18)20(24-12-3-4-13-24)15-22-21(27)23-17-6-5-7-19(14-17)26-2/h5-11,14,20H,3-4,12-13,15H2,1-2H3,(H2,22,23,27)/p+1/t20-/m1/s1 |
| InChIKey | QTKGWSKBNPBYIJ-HXUWFJFHSA-O |
| XLogP | 2.41 |
| TPSA | 46.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|