C18H24N3S2+ — CID 8657261
1-(3-methylphenyl)-3-[(2S)-2-pyrrolidin-1-ium-1-yl-2-thiophen-2-ylethyl]thiourea (PubChem CID 8657261) has the molecular formula C18H24N3S2+ and a molecular weight of 346.55 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-[(2S)-2-pyrrolidin-1-ium-1-yl-2-thiophen-2-ylethyl]thiourea.
| Compound Name | 1-(3-methylphenyl)-3-[(2S)-2-pyrrolidin-1-ium-1-yl-2-thiophen-2-ylethyl]thiourea |
|---|---|
| PubChem CID | 8657261 |
| Molecular Formula | C18H24N3S2+ |
| Molecular Weight | 346.55 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-(3-methylphenyl)-3-[(2S)-2-pyrrolidin-1-ium-1-yl-2-thiophen-2-ylethyl]thiourea |
| SMILES | Cc1cccc(NC(=S)NC[C@@H](c2cccs2)[NH+]2CCCC2)c1 |
| InChI | InChI=1S/C18H23N3S2/c1-14-6-4-7-15(12-14)20-18(22)19-13-16(17-8-5-11-23-17)21-9-2-3-10-21/h4-8,11-12,16H,2-3,9-10,13H2,1H3,(H2,19,20,22)/p+1/t16-/m0/s1 |
| InChIKey | MNNQYMKLBREWKQ-INIZCTEOSA-O |
| XLogP | 2.76 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.55 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|