C23H30FN3OS — CID 8684253
1-(4-butylphenyl)-3-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]thiourea (PubChem CID 8684253) has the molecular formula C23H30FN3OS and a molecular weight of 415.58 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]thiourea.
| Compound Name | 1-(4-butylphenyl)-3-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]thiourea |
|---|---|
| PubChem CID | 8684253 |
| Molecular Formula | C23H30FN3OS |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 1-(4-butylphenyl)-3-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]thiourea |
| SMILES | CCCCc1ccc(NC(=S)NC[C@H](c2ccc(F)cc2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H30FN3OS/c1-2-3-4-18-5-11-21(12-6-18)26-23(29)25-17-22(27-13-15-28-16-14-27)19-7-9-20(24)10-8-19/h5-12,22H,2-4,13-17H2,1H3,(H2,25,26,29)/t22-/m1/s1 |
| InChIKey | PFFOGIHYWWRQCA-JOCHJYFZSA-N |
| XLogP | 4.53 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|