C22H32N4OS+2 — CID 2149902
1-(2-methoxyphenyl)-3-[(1S,2R)-1-(4-methylpiperazine-1,4-diium-1-yl)-1-phenylpropan-2-yl]thiourea (PubChem CID 2149902) has the molecular formula C22H32N4OS+2 and a molecular weight of 400.59 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-[(1S,2R)-1-(4-methylpiperazine-1,4-diium-1-yl)-1-phenylpropan-2-yl]thiourea.
| Compound Name | 1-(2-methoxyphenyl)-3-[(1S,2R)-1-(4-methylpiperazine-1,4-diium-1-yl)-1-phenylpropan-2-yl]thiourea |
|---|---|
| PubChem CID | 2149902 |
| Molecular Formula | C22H32N4OS+2 |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-[(1S,2R)-1-(4-methylpiperazine-1,4-diium-1-yl)-1-phenylpropan-2-yl]thiourea |
| SMILES | COc1ccccc1NC(=S)N[C@H](C)[C@H](c1ccccc1)[NH+]1CC[NH+](C)CC1 |
| InChI | InChI=1S/C22H30N4OS/c1-17(23-22(28)24-19-11-7-8-12-20(19)27-3)21(18-9-5-4-6-10-18)26-15-13-25(2)14-16-26/h4-12,17,21H,13-16H2,1-3H3,(H2,23,24,28)/p+2/t17-,21-/m1/s1 |
| InChIKey | DAHNHJCGFXWVRJ-DYESRHJHSA-P |
| XLogP | 0.52 |
| TPSA | 42.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|