C19H27N3S2 — CID 8684319
1-(2,6-diethylphenyl)-3-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]thiourea (PubChem CID 8684319) has the molecular formula C19H27N3S2 and a molecular weight of 361.58 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]thiourea.
| Compound Name | 1-(2,6-diethylphenyl)-3-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]thiourea |
|---|---|
| PubChem CID | 8684319 |
| Molecular Formula | C19H27N3S2 |
| Molecular Weight | 361.58 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-[(2S)-2-(dimethylamino)-2-thiophen-2-ylethyl]thiourea |
| SMILES | CCc1cccc(CC)c1NC(=S)NC[C@@H](c1cccs1)N(C)C |
| InChI | InChI=1S/C19H27N3S2/c1-5-14-9-7-10-15(6-2)18(14)21-19(23)20-13-16(22(3)4)17-11-8-12-24-17/h7-12,16H,5-6,13H2,1-4H3,(H2,20,21,23)/t16-/m0/s1 |
| InChIKey | MTAJEIODCNXMJJ-INIZCTEOSA-N |
| XLogP | 4.46 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|