C19H28F2N3OS2+ — CID 8683527
1-[4-(difluoromethylsulfanyl)phenyl]-3-[(1-morpholin-4-ium-4-ylcyclohexyl)methyl]thiourea (PubChem CID 8683527) has the molecular formula C19H28F2N3OS2+ and a molecular weight of 416.58 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(1-morpholin-4-ium-4-ylcyclohexyl)methyl]thiourea.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(1-morpholin-4-ium-4-ylcyclohexyl)methyl]thiourea |
|---|---|
| PubChem CID | 8683527 |
| Molecular Formula | C19H28F2N3OS2+ |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(1-morpholin-4-ium-4-ylcyclohexyl)methyl]thiourea |
| SMILES | FC(F)Sc1ccc(NC(=S)NCC2([NH+]3CCOCC3)CCCCC2)cc1 |
| InChI | InChI=1S/C19H27F2N3OS2/c20-17(21)27-16-6-4-15(5-7-16)23-18(26)22-14-19(8-2-1-3-9-19)24-10-12-25-13-11-24/h4-7,17H,1-3,8-14H2,(H2,22,23,26)/p+1 |
| InChIKey | RPIPDQICEBMTRT-UHFFFAOYSA-O |
| XLogP | 2.91 |
| TPSA | 37.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|