C20H30F2N3S2+ — CID 7944814
1-[4-(difluoromethylsulfanyl)phenyl]-3-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]thiourea (PubChem CID 7944814) has the molecular formula C20H30F2N3S2+ and a molecular weight of 414.61 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]thiourea.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]thiourea |
|---|---|
| PubChem CID | 7944814 |
| Molecular Formula | C20H30F2N3S2+ |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]thiourea |
| SMILES | FC(F)Sc1ccc(NC(=S)NCC2([NH+]3CCCCC3)CCCCC2)cc1 |
| InChI | InChI=1S/C20H29F2N3S2/c21-18(22)27-17-9-7-16(8-10-17)24-19(26)23-15-20(11-3-1-4-12-20)25-13-5-2-6-14-25/h7-10,18H,1-6,11-15H2,(H2,23,24,26)/p+1 |
| InChIKey | YJFZVPVENYHKAL-UHFFFAOYSA-O |
| XLogP | 4.06 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|