C18H24N3OS+ — CID 8628742
1-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3-(2-methylphenyl)thiourea (PubChem CID 8628742) has the molecular formula C18H24N3OS+ and a molecular weight of 330.48 g/mol. Its IUPAC name is 1-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3-(2-methylphenyl)thiourea.
| Compound Name | 1-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 8628742 |
| Molecular Formula | C18H24N3OS+ |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3-(2-methylphenyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)NC[C@@H](c1ccco1)[NH+]1CCCC1 |
| InChI | InChI=1S/C18H23N3OS/c1-14-7-2-3-8-15(14)20-18(23)19-13-16(17-9-6-12-22-17)21-10-4-5-11-21/h2-3,6-9,12,16H,4-5,10-11,13H2,1H3,(H2,19,20,23)/p+1/t16-/m0/s1 |
| InChIKey | OVTFWTGFGNBCAV-INIZCTEOSA-O |
| XLogP | 2.29 |
| TPSA | 41.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|